| Product Name | 3-Bromo-2-nitrotoluene |
| CAS No. | 52414-97-8 |
| Synonyms | Benzene, 1-bromo-3-methyl-2-nitro-; 1-bromo-3-methyl-2-nitrobenzene; 3-Bromo-2-nitrobenzene |
| InChI | InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.032 |
| Density | 1.615g/cm3 |
| Melting point | 26.8-29℃ |
| Boiling point | 237.4°C at 760 mmHg |
| Flash point | 97.4°C |
| Refractive index | 1.592 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
52414-97-8 3-bromo-2-nitrotoluene
service@apichina.com