| Product Name | 3-Bromo-2-hydroxy-5-nitrobenzaldehyde |
| CAS No. | 16789-84-7 |
| Synonyms | 3-Bromo-5-nitrosalicylaldehyde |
| InChI | InChI=1/C7H4BrNO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.015 |
| Density | 1.928g/cm3 |
| Boiling point | 299.6°C at 760 mmHg |
| Flash point | 135°C |
| Refractive index | 1.696 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16789-84-7 3-bromo-2-hydroxy-5-nitrobenzaldehyde
service@apichina.com