| Product Name | 3-Bromo-2,5-dichlorothiophene |
| CAS No. | 60404-18-4 |
| InChI | InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
| Molecular Formula | C4HBrCl2S |
| Molecular Weight | 231.9257 |
| Density | 1.949g/cm3 |
| Boiling point | 223.1°C at 760 mmHg |
| Flash point | 88.7°C |
| Refractive index | 1.625 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
60404-18-4 3-bromo-2,5-dichlorothiophene
service@apichina.com