| Product Name | 3-bromo-1,1-diphenylacetone |
| CAS No. | 33609-25-5 |
| Synonyms | 3-bromo-1,1-diphenylpropan-2-one |
| InChI | InChI=1/C15H13BrO/c16-11-14(17)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.1671 |
| Density | 1.358g/cm3 |
| Boiling point | 364.9°C at 760 mmHg |
| Flash point | 49°C |
| Refractive index | 1.597 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
33609-25-5 3-bromo-1,1-diphenylacetone
service@apichina.com