| Product Name | 3-Benzyloxyphenyl isothiocyanate |
| CAS No. | 206559-36-6 |
| Synonyms | 1-(benzyloxy)-3-isothiocyanatobenzene |
| InChI | InChI=1/C14H11NOS/c17-11-15-13-7-4-8-14(9-13)16-10-12-5-2-1-3-6-12/h1-9H,10H2 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.3082 |
| Density | 1.09g/cm3 |
| Boiling point | 398.3°C at 760 mmHg |
| Flash point | 194.7°C |
| Refractive index | 1.582 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
206559-36-6 3-benzyloxyphenyl isothiocyanate
service@apichina.com