| Product Name | 3-Benzyloxy-4-methoxybenzoic acid |
| CAS No. | 58452-00-9 |
| Synonyms | 3-Benzyloxy-p-anisic acid |
| InChI | InChI=1/C15H14O4/c1-18-13-8-7-12(15(16)17)9-14(13)19-10-11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,16,17) |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.2693 |
| Density | 1.225g/cm3 |
| Boiling point | 416.6°C at 760 mmHg |
| Flash point | 156°C |
| Refractive index | 1.589 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
58452-00-9 3-benzyloxy-4-methoxybenzoic acid
service@apichina.com