| Product Name | 3-Benzylaniline |
| CAS No. | 61424-26-8 |
| InChI | InChI=1/C13H13N/c14-13-8-4-7-12(10-13)9-11-5-2-1-3-6-11/h1-8,10H,9,14H2 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.249 |
| Density | 1.07g/cm3 |
| Boiling point | 327.2°C at 760 mmHg |
| Flash point | 162.5°C |
| Refractive index | 1.616 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
61424-26-8 3-benzylaniline
service@apichina.com