| Product Name | 3-(benzylamino)-4-ethoxycyclobut-3-ene-1,2-dione |
| CAS No. | 144913-06-4 |
| InChI | InChI=1/C13H13NO3/c1-2-17-13-10(11(15)12(13)16)14-8-9-6-4-3-5-7-9/h3-7,14H,2,8H2,1H3 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.2472 |
| Density | 1.23g/cm3 |
| Melting point | 68℃ |
| Boiling point | 396°C at 760 mmHg |
| Flash point | 193.3°C |
| Refractive index | 1.577 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
144913-06-4 3-(benzylamino)-4-ethoxycyclobut-3-ene-1,2-dione
service@apichina.com