| Product Name | 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
| CAS No. | 175203-47-1 |
| Synonyms | 3-benzyl-1-(1-methylethyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
| InChI | InChI=1/C15H15N3O2/c1-11(2)17-10-13(8-16)14(19)18(15(17)20)9-12-6-4-3-5-7-12/h3-7,10-11H,9H2,1-2H3 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.2985 |
| Density | 1.26g/cm3 |
| Melting point | 151℃ |
| Boiling point | 399.1°C at 760 mmHg |
| Flash point | 195.1°C |
| Refractive index | 1.609 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175203-47-1 3-benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
service@apichina.com