| Product Name | 3-aminothieno[2,3-b]pyridine-2-carboxylic acid |
| CAS No. | 58327-75-6 |
| Synonyms | 3-Aminothieno(2,3-b)pyridine-2-carboxylic acid; NSC 284503 |
| InChI | InChI=1/C8H6N2O2S/c9-5-4-2-1-3-10-7(4)13-6(5)8(11)12/h1-3H,9H2,(H,11,12) |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.2104 |
| Density | 1.604g/cm3 |
| Melting point | 278℃ |
| Boiling point | 453.3°C at 760 mmHg |
| Flash point | 228°C |
| Refractive index | 1.799 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
58327-75-6 3-aminothieno[2,3-b]pyridine-2-carboxylic acid
service@apichina.com