| Product Name | 3-Aminophenylpropanoic Acid |
| CAS No. | 1664-54-6 |
| Synonyms | 3-(3-Aminophenyl)propionic acid; 3-amino-3-phenylpropanoic acid; 3-(3-aminophenyl)propanoic acid |
| InChI | InChI=1/C9H11NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5,10H2,(H,11,12) |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.217g/cm3 |
| Boiling point | 356.2°C at 760 mmHg |
| Flash point | 169.2°C |
| Refractive index | 1.597 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1664-54-6 3-aminophenylpropanoic acid
service@apichina.com