| Product Name | 3-(aminomethyl)-N,N-dimethyltetrahydro-3-thiophenamine |
| CAS No. | 176445-79-7 |
| Synonyms | 3-(aminomethyl)-N,N-dimethyltetrahydrothiophen-3-amine |
| InChI | InChI=1/C7H16N2S/c1-9(2)7(5-8)3-4-10-6-7/h3-6,8H2,1-2H3 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.2803 |
| Density | 1.06g/cm3 |
| Boiling point | 244.8°C at 760 mmHg |
| Flash point | 101.9°C |
| Refractive index | 1.549 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
176445-79-7 3-(aminomethyl)-n,n-dimethyltetrahydro-3-thiophenamine
service@apichina.com