| Product Name | 3-Aminocoumarin |
| CAS No. | 1635-31-0 |
| Synonyms | 3-Coumarinamine; 3-amino-2H-chromen-2-one |
| InChI | InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.1574 |
| Density | 1.313g/cm3 |
| Boiling point | 355.2°C at 760 mmHg |
| Flash point | 199.3°C |
| Refractive index | 1.624 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1635-31-0 3-aminocoumarin
service@apichina.com