Product Name | 3-Amino-6-chloro-4-picoline |
CAS No. | 66909-38-4 |
Synonyms | 2-CHLORO-4-METHYL-5-AMINOPYRIDINE; 6-chloro-4-methylpyridin-3-amine; 5-Amino-2-chloro-4-methylpyridine; 5-amino-2-chloro-4-picoline |
InChI | InChI=1/C6H7ClN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
Molecular Formula | C6H7ClN2 |
Molecular Weight | 142.5862 |
Density | 1.26g/cm3 |
Boiling point | 309.7°C at 760 mmHg |
Flash point | 141.1°C |
Refractive index | 1.592 |
Hazard Symbols | |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
66909-38-4 3-amino-6-chloro-4-picoline
service@apichina.com