| Product Name | (3-Amino-4-methylphenyl)boronic acid, hydrochloride |
| CAS No. | 22237-12-3 |
| Synonyms | 3-Amino-4-methylphenylboronic acid~3-Amino-p-tolylboronic acid; 3-Amino-4-methylbenzeneboronic acid; 5-(dihydroxyboranyl)-2-methylanilinium chloride; (3-amino-4-methylphenyl)boronic acid; 3-Amino-4-Methylphenylboronic Acid Hydrochloride |
| InChI | InChI=1/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 |
| Molecular Formula | C7H10BNO2 |
| Molecular Weight | 150.9708 |
| Density | 1.19g/cm3 |
| Boiling point | 367.6°C at 760 mmHg |
| Flash point | 176.1°C |
| Refractive index | 1.569 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
22237-12-3 (3-amino-4-methylphenyl)boronic acid, hydrochloride
service@apichina.com