| Product Name | 3-amino-4-(methylamino)benzonitrile |
| CAS No. | 64910-46-9 |
| InChI | InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.1772 |
| Density | 1.155g/cm3 |
| Melting point | 136℃ |
| Boiling point | 346.783°C at 760 mmHg |
| Flash point | 163.529°C |
| Refractive index | 1.593 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
64910-46-9 3-amino-4-(methylamino)benzonitrile
service@apichina.com