| Product Name | 3-Amino-4-chloropyridine |
| CAS No. | 20511-15-3 |
| Synonyms | 4-Chloro-3-pyridinamine; 4-Chloro-3-aminopyridine; 4-chloropyridin-3-amine; 4-CHLORO-PYRIDIN-3-YLAMINE |
| InChI | InChI=1/C5H5ClN2/c6-4-1-2-8-3-5(4)7/h1-3H,7H2 |
| Molecular Formula | C5H5ClN2 |
| Molecular Weight | 128.5596 |
| Density | 1.326g/cm3 |
| Boiling point | 247.6°C at 760 mmHg |
| Flash point | 103.5°C |
| Refractive index | 1.607 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
20511-15-3 3-amino-4-chloropyridine
service@apichina.com