| Product Name | 3-Amino-4-(1-pyrrolidino)benzotrifluoride |
| CAS No. | 133184-80-2 |
| Synonyms | N-[2-Amino-4-(trifluoromethyl)phenyl]pyrrolidine; 2-(pyrrolidin-1-yl)-5-(trifluoromethyl)aniline; (2E)-3-(2-chloro-4-fluorophenyl)prop-2-enoic acid |
| InChI | InChI=1/C9H6ClFO2/c10-8-5-7(11)3-1-6(8)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.5941 |
| Density | 1.42g/cm3 |
| Boiling point | 312.8°C at 760 mmHg |
| Flash point | 143°C |
| Refractive index | 1.604 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
133184-80-2 3-amino-4-(1-pyrrolidino)benzotrifluoride
service@apichina.com