| Product Name | 3-Amino-3-(2-nitrophenyl)propionic acid |
| CAS No. | 5678-48-8 |
| Synonyms | 3-Amino-3-(2-nitrophenyl)propanoic acid; (3R)-3-amino-3-(2-nitrophenyl)propanoic acid; (3S)-3-ammonio-3-(2-nitrophenyl)propanoate |
| InChI | InChI=1/C9H10N2O4/c10-7(5-9(12)13)6-3-1-2-4-8(6)11(14)15/h1-4,7H,5,10H2,(H,12,13)/t7-/m0/s1 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.1867 |
| Density | 1.404g/cm3 |
| Melting point | 218℃ |
| Boiling point | 423.8°C at 760 mmHg |
| Flash point | 210.1°C |
| Refractive index | 1.612 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5678-48-8 3-amino-3-(2-nitrophenyl)propionic acid
service@apichina.com