| Product Name | 3-amino-2-methylquinoline-4-carboxylic acid |
| CAS No. | 71881-80-6 |
| InChI | InChI=1/C11H10N2O2/c1-6-10(12)9(11(14)15)7-4-2-3-5-8(7)13-6/h2-5H,12H2,1H3,(H,14,15) |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.2093 |
| Density | 1.367g/cm3 |
| Melting point | 231℃ |
| Boiling point | 378.6°C at 760 mmHg |
| Flash point | 182.7°C |
| Refractive index | 1.716 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
71881-80-6 3-amino-2-methylquinoline-4-carboxylic acid
service@apichina.com