| Product Name | 3-Amino-2-cyclohexen-1-one |
| CAS No. | 5220-49-5 |
| Synonyms | 3-aminocyclohex-2-enone; 3-aminocyclohex-2-en-1-one; methyl 1-methyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropyrido[2,3-d]pyrimidine-5-carboxylate; (3E)-3-iminocyclohexanone; 3-AMINO-2-CYCLOHEXENE-1-ONE |
| InChI | InChI=1/C6H9NO/c7-5-2-1-3-6(8)4-5/h7H,1-4H2/b7-5+ |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.1418 |
| Density | 1.17g/cm3 |
| Boiling point | 286.5°C at 760 mmHg |
| Flash point | 127.1°C |
| Refractive index | 1.558 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5220-49-5 3-amino-2-cyclohexen-1-one
service@apichina.com