| Product Name | 3-Amino-2,6-dimethoxypyridine monohydrochloride |
| CAS No. | 80789-72-6 |
| InChI | InChI=1/C7H10N2O2.ClH/c1-10-6-4-3-5(8)7(9-6)11-2;/h3-4H,8H2,1-2H3;1H |
| Molecular Formula | C7H11ClN2O2 |
| Molecular Weight | 190.6274 |
| Melting point | 212℃ |
| Boiling point | 265.7°C at 760 mmHg |
| Flash point | 114.5°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
80789-72-6 3-amino-2,6-dimethoxypyridine monohydrochloride
service@apichina.com