| Product Name | 3-amino-2-(2,4-difluorophenoxy)pyridine |
| CAS No. | 175135-63-4 |
| Synonyms | 2-(2,4-Difluorophenoxy)pyridin-3-amine; 2-(4-fluorophenoxy)pyridin-3-amine |
| InChI | InChI=1/C11H9FN2O/c12-8-3-5-9(6-4-8)15-11-10(13)2-1-7-14-11/h1-7H,13H2 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.2004 |
| Density | 1.278g/cm3 |
| Melting point | 95-96℃ |
| Boiling point | 328.8°C at 760 mmHg |
| Flash point | 152.7°C |
| Refractive index | 1.605 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175135-63-4 3-amino-2-(2,4-difluorophenoxy)pyridine
service@apichina.com