| Product Name | 3-Acetylphenyl isocyanate |
| CAS No. | 23138-64-9 |
| Synonyms | 3-Isocyanatoacetophenone; 1-(3-isocyanatophenyl)ethanone |
| InChI | InChI=1/C9H7NO2/c1-7(12)8-3-2-4-9(5-8)10-6-11/h2-5H,1H3 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.1574 |
| Density | 1.09g/cm3 |
| Melting point | 33-34℃ |
| Boiling point | 271.1°C at 760 mmHg |
| Flash point | 108.8°C |
| Refractive index | 1.537 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
23138-64-9 3-acetylphenyl isocyanate
service@apichina.com