| Product Name | 3-Acetylacrylic acid |
| CAS No. | 4743-82-2 |
| Synonyms | 4-Ketopent-2-enoic acid~4-Oxopent-2-enoic acid; 4-oxopent-2-enoic acid; (2Z)-4-oxopent-2-enoic acid; (2E)-4-oxopent-2-enoic acid |
| InChI | InChI=1/C5H6O3/c1-4(6)2-3-5(7)8/h2-3H,1H3,(H,7,8)/b3-2+ |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.0993 |
| Density | 1.183g/cm3 |
| Boiling point | 269.7°C at 760 mmHg |
| Flash point | 131.2°C |
| Refractive index | 1.469 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4743-82-2 3-acetylacrylic acid
service@apichina.com