| Product Name | 3-acetoxypyridine |
| CAS No. | 17747-43-2 |
| Synonyms | Acetoxypyridine; 3-Pyridyl acetate; pyridin-3-yl acetate |
| InChI | InChI=1/C7H7NO2/c1-6(9)10-7-3-2-4-8-5-7/h2-5H,1H3 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.136 |
| Density | 1.14g/cm3 |
| Boiling point | 218.6°C at 760 mmHg |
| Flash point | 86°C |
| Refractive index | 1.505 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17747-43-2 3-acetoxypyridine
service@apichina.com