| Product Name | 3-Acetoxybenzo[b]furan |
| CAS No. | 93680-80-9 |
| Synonyms | Benzo[b]furan-3-yl acetate; 1-benzofuran-3-yl acetate |
| InChI | InChI=1/C10H8O3/c1-7(11)13-10-6-12-9-5-3-2-4-8(9)10/h2-6H,1H3 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.1687 |
| Density | 1.223g/cm3 |
| Boiling point | 264.2°C at 760 mmHg |
| Flash point | 113.6°C |
| Water solubility | immiscible |
| Refractive index | 1.577 |
| Hazard Symbols | |
| Risk Codes | R22:; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
93680-80-9 3-acetoxybenzo[b]furan
service@apichina.com