| Product Name | 3-Acetoxy-2-Methylbenzoyl Chloride |
| CAS No. | 167678-46-8 |
| Synonyms | 3-Acetoxy-o-toluoyl chloride; 2-methyl-3-acetoxybenzoic chloride; 3-acetoxy-2-methylbenzoic chloride; 3-(chlorocarbonyl)-2-methylphenyl acetate; 2-methyl-3-acetoxy benzoic chloride |
| InChI | InChI=1/C10H9ClO3/c1-6-8(10(11)13)4-3-5-9(6)14-7(2)12/h3-5H,1-2H3 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.6297 |
| Density | 1.252g/cm3 |
| Boiling point | 295.6°C at 760 mmHg |
| Flash point | 123.6°C |
| Refractive index | 1.532 |
| Risk Codes | R34:Causes burns.; R43:May cause sensitization by skin contact.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
167678-46-8 3-acetoxy-2-methylbenzoyl chloride
service@apichina.com