| Product Name | 3-Acetoxy-2-butanone |
| CAS No. | 4906-24-5 |
| Synonyms | Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
| InChI | InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.1418 |
| Density | 1.012g/cm3 |
| Boiling point | 163.4°C at 760 mmHg |
| Flash point | 56.6°C |
| Refractive index | 1.406 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4906-24-5 3-acetoxy-2-butanone
service@apichina.com