| Product Name | 3-Acetamido-4-methoxybenzenesulfinic acid,hydrate |
| CAS No. | 205526-67-6 |
| Synonyms | 2-Acetamidoanisole-4-sulfinic acid, hydrate; 3-(acetylamino)-4-methoxybenzenesulfinate |
| InChI | InChI=1/C9H11NO4S/c1-6(11)10-8-5-7(15(12)13)3-4-9(8)14-2/h3-5H,1-2H3,(H,10,11)(H,12,13)/p-1 |
| Molecular Formula | C9H10NO4S |
| Molecular Weight | 228.2455 |
| Melting point | 116-118℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
205526-67-6 3-acetamido-4-methoxybenzenesulfinic acid,hydrate
service@apichina.com