| Product Name | 3,8-Dimethoxy-2-naphthaldehyde |
| CAS No. | 374538-05-3 |
| Synonyms | 3,8-dimethoxynaphthalene-2-carbaldehyde |
| InChI | InChI=1/C13H12O3/c1-15-12-5-3-4-9-7-13(16-2)10(8-14)6-11(9)12/h3-8H,1-2H3 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.2326 |
| Density | 1.18g/cm3 |
| Boiling point | 384.6°C at 760 mmHg |
| Flash point | 177.9°C |
| Refractive index | 1.618 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374538-05-3 3,8-dimethoxy-2-naphthaldehyde
service@apichina.com