| Product Name | 3,5-Heptanedione |
| CAS No. | 7424-54-6 |
| Synonyms | heptane-3,5-dione; (4Z)-5-hydroxyhept-4-en-3-one; 3,5-HEPTANDIONE |
| InChI | InChI=1/C7H12O2/c1-3-6(8)5-7(9)4-2/h5,8H,3-4H2,1-2H3/b6-5- |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.97g/cm3 |
| Boiling point | 216.1°C at 760 mmHg |
| Flash point | 86.3°C |
| Refractive index | 1.456 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
7424-54-6 3,5-heptanedione
service@apichina.com