| Product Name | 3,5-Dinitro-4-hydroxybenzoic acid |
| CAS No. | 1019-52-9 |
| Synonyms | 4-Hydroxy-3,5-dinitrobenzoic acid; 3,5-dinitro-4-oxidobenzoate |
| InChI | InChI=1/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)/p-2 |
| Molecular Formula | C7H2N2O7 |
| Molecular Weight | 226.1011 |
| Melting point | 249-252℃ |
| Boiling point | 349.4°C at 760 mmHg |
| Flash point | 155.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1019-52-9 3,5-dinitro-4-hydroxybenzoic acid
service@apichina.com