| Product Name | 3,5-Dinitro-2-hydroxybenzaldehyde |
| CAS No. | 2460-59-5 |
| Synonyms | 3,5-Dinitrosalicylaldehyde; 2-hydroxy-3,5-dinitrobenzaldehyde; 2-formyl-4,6-dinitrophenolate |
| InChI | InChI=1/C7H4N2O6/c10-3-4-1-5(8(12)13)2-6(7(4)11)9(14)15/h1-3,11H/p-1 |
| Molecular Formula | C7H3N2O6 |
| Molecular Weight | 211.1091 |
| Boiling point | 301.5°C at 760 mmHg |
| Flash point | 133.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2460-59-5 3,5-dinitro-2-hydroxybenzaldehyde
service@apichina.com