| Product Name | 3,5-Dimethylphenylthiourea |
| CAS No. | 97480-60-9 |
| Synonyms | 1-(3,5-dimethylphenyl)thiourea |
| InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.27 |
| Density | 1.2g/cm3 |
| Boiling point | 293.9°C at 760 mmHg |
| Flash point | 131.5°C |
| Refractive index | 1.674 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
97480-60-9 3,5-dimethylphenylthiourea
service@apichina.com