| Product Name | 3,5-Dimethylisothiocyanatobenzene |
| CAS No. | 40046-30-8 |
| Synonyms | 3,5-Dimethylphenyl isothiocyanate; 1-isothiocyanato-3,5-dimethylbenzene |
| InChI | InChI=1/C9H9NS/c1-7-3-8(2)5-9(4-7)10-6-11/h3-5H,1-2H3 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.2395 |
| Density | 1.01g/cm3 |
| Boiling point | 282.2°C at 760 mmHg |
| Flash point | 127.3°C |
| Refractive index | 1.554 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
40046-30-8 3,5-dimethylisothiocyanatobenzene
service@apichina.com