| Product Name | (3,5-Dimethyl-4-methoxyphenyl)boronic acid |
| CAS No. | 301699-39-8 |
| Synonyms | 4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
| InChI | InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
| Molecular Formula | C9H13BO3 |
| Molecular Weight | 180.0087 |
| Density | 1.11g/cm3 |
| Melting point | 235-242℃ |
| Boiling point | 335.8°C at 760 mmHg |
| Flash point | 156.9°C |
| Refractive index | 1.517 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
301699-39-8 (3,5-dimethyl-4-methoxyphenyl)boronic acid
service@apichina.com