| Product Name | 3,5-Dimethoxyphenylacetonitrile |
| CAS No. | 13388-75-5 |
| InChI | InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.1998 |
| Density | 1.082g/cm3 |
| Boiling point | 316.7°C at 760 mmHg |
| Flash point | 127.3°C |
| Refractive index | 1.511 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
13388-75-5 3,5-dimethoxyphenylacetonitrile
service@apichina.com