| Product Name | 3,5-Dimethoxyphenyl isothiocyanate |
| CAS No. | 104968-58-3 |
| Synonyms | 1-isothiocyanato-3,5-dimethoxybenzene |
| InChI | InChI=1/C9H9NO2S/c1-11-8-3-7(10-6-13)4-9(5-8)12-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.2383 |
| Density | 1.12g/cm3 |
| Melting point | 50-52℃ |
| Boiling point | 338.1°C at 760 mmHg |
| Flash point | 158.3°C |
| Refractive index | 1.537 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
104968-58-3 3,5-dimethoxyphenyl isothiocyanate
service@apichina.com