| Product Name | 3,5-Dimethoxybenzoyl chloride |
| CAS No. | 17213-57-9 |
| InChI | InChI=1/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.619 |
| Density | 1.224g/cm3 |
| Melting point | 41-47℃ |
| Boiling point | 284.5°C at 760 mmHg |
| Flash point | 131.1°C |
| Refractive index | 1.52 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
17213-57-9 3,5-dimethoxybenzoyl chloride
service@apichina.com