| Product Name | 3,5-Dimethoxy-4-hydroxybenzhydrazide |
| CAS No. | 1443-76-1 |
| Synonyms | 4-Hydroxy-3,5-dimethoxybenzohydrazide; Benzoic acid, 4-hydroxy-3,5-dimethoxy-, hydrazide |
| InChI | InChI=1/C9H12N2O4/c1-14-6-3-5(9(13)11-10)4-7(15-2)8(6)12/h3-4,12H,10H2,1-2H3,(H,11,13) |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.2026 |
| Density | 1.298g/cm3 |
| Refractive index | 1.575 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1443-76-1 3,5-dimethoxy-4-hydroxybenzhydrazide
service@apichina.com