| Product Name | 3,5-Dihydroxybenzonitrile |
| CAS No. | 19179-36-3 |
| InChI | InChI=1/C7H5NO2/c8-4-5-1-6(9)3-7(10)2-5/h1-3,9-10H |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.1201 |
| Density | 1.42g/cm3 |
| Boiling point | 336.4°C at 760 mmHg |
| Flash point | 157.2°C |
| Refractive index | 1.647 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
19179-36-3 3,5-dihydroxybenzonitrile
service@apichina.com