| Product Name | 3,5-Dihydroxy-2-naphthalenecarboxylic acid |
| CAS No. | 89-35-0 |
| Synonyms | 3,5-Dihydroxy-2-naphthoic acid; 3,5-dihydroxynaphthalene-2-carboxylic acid; 3,5-dihydroxynaphthalene-2-carboxylate |
| InChI | InChI=1/C11H8O4/c12-9-3-1-2-6-4-8(11(14)15)10(13)5-7(6)9/h1-5,12-13H,(H,14,15)/p-1 |
| Molecular Formula | C11H7O4 |
| Molecular Weight | 203.1714 |
| Melting point | 275-280℃ |
| Boiling point | 442.2°C at 760 mmHg |
| Flash point | 235.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
89-35-0 3,5-dihydroxy-2-naphthalenecarboxylic acid
service@apichina.com