| Product Name | 3,5-Difluoropyridine |
| CAS No. | 71902-33-5 |
| InChI | InChI=1/C5H3F2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| Molecular Formula | C5H3F2N |
| Molecular Weight | 115.0808 |
| Density | 1.263g/cm3 |
| Boiling point | 79.4°C at 760 mmHg |
| Flash point | 1.9°C |
| Refractive index | 1.446 |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
71902-33-5 3,5-difluoropyridine
service@apichina.com