| Product Name | 3,5-difluoropropiophenone |
| CAS No. | 135306-45-5 |
| Synonyms | 1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
| InChI | InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.156 |
| Density | 1.179g/cm3 |
| Melting point | 25-27℃ |
| Boiling point | 191.5°C at 760 mmHg |
| Flash point | 70.6°C |
| Refractive index | 1.472 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
135306-45-5 3,5-difluoropropiophenone
service@apichina.com