| Product Name | 3,5-difluoromandelic acid |
| CAS No. | 132741-31-2 |
| Synonyms | alpha-Hydroxy-3,5-difluorophenylacetic acid; (3,5-difluorophenyl)(hydroxy)acetic acid; (2S)-(3,5-difluorophenyl)(hydroxy)ethanoate; (2R)-(3,5-difluorophenyl)(hydroxy)ethanoate |
| InChI | InChI=1/C8H6F2O3/c9-5-1-4(2-6(10)3-5)7(11)8(12)13/h1-3,7,11H,(H,12,13)/p-1/t7-/m1/s1 |
| Molecular Formula | C8H5F2O3 |
| Molecular Weight | 187.1209 |
| Melting point | 135-139℃ |
| Boiling point | 306.5°C at 760 mmHg |
| Flash point | 139.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
132741-31-2 3,5-difluoromandelic acid
service@apichina.com