| Product Name | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
| CAS No. | 216393-57-6 |
| Synonyms | 2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChI | InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3 |
| Molecular Formula | C11H13BF2O2 |
| Molecular Weight | 226.0275 |
| Density | 1.14g/cm3 |
| Boiling point | 290.9°C at 760 mmHg |
| Flash point | 129.8°C |
| Refractive index | 1.468 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
216393-57-6 3,5-difluorobenzeneboronic acid neopentyl glycol cyclic ester
service@apichina.com