| Product Name | 3,5-difluoro-4-hydroxypropiophenone |
| CAS No. | 178374-78-2 |
| Synonyms | 3',5'-difluoro-4'-hydroxypropiophenone; 1-(3,5-difluoro-4-hydroxyphenyl)propan-1-one |
| InChI | InChI=1/C9H8F2O2/c1-2-8(12)5-3-6(10)9(13)7(11)4-5/h3-4,13H,2H2,1H3 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.1554 |
| Density | 1.289g/cm3 |
| Melting point | 126-128℃ |
| Boiling point | 271.2°C at 760 mmHg |
| Flash point | 117.8°C |
| Refractive index | 1.504 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
178374-78-2 3,5-difluoro-4-hydroxypropiophenone
service@apichina.com