| Product Name | 3,5-Diethyl-2-n-propylpyridine |
| CAS No. | 4808-75-7 |
| Synonyms | 3,5-Diethyl-2-propylpyridine |
| InChI | InChI=1/C12H19N/c1-4-7-12-11(6-3)8-10(5-2)9-13-12/h8-9H,4-7H2,1-3H3 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.286 |
| Density | 0.897g/cm3 |
| Boiling point | 250.4°C at 760 mmHg |
| Flash point | 94.9°C |
| Refractive index | 1.494 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4808-75-7 3,5-diethyl-2-n-propylpyridine
service@apichina.com