| Product Name | 3,5-Dichlorophenylhydrazine |
| CAS No. | 39943-56-1 |
| InChI | InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
| Molecular Formula | C6H6Cl2N2 |
| Molecular Weight | 177.0312 |
| Density | 1.475g/cm3 |
| Boiling point | 286.1°C at 760 mmHg |
| Flash point | 126.8°C |
| Refractive index | 1.665 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
39943-56-1 3,5-dichlorophenylhydrazine
service@apichina.com